C24H33NO3Si — CID 11200741
4-[tert-butyl(diphenyl)silyl]oxy-1-morpholin-4-ylbutan-1-one (PubChem CID 11200741) has the molecular formula C24H33NO3Si and a molecular weight of 411.62 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-1-morpholin-4-ylbutan-1-one.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 11200741 |
| Molecular Formula | C24H33NO3Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-morpholin-4-ylbutan-1-one |
| SMILES | CC(C)(C)[Si](OCCCC(=O)N1CCOCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO3Si/c1-24(2,3)29(21-11-6-4-7-12-21,22-13-8-5-9-14-22)28-18-10-15-23(26)25-16-19-27-20-17-25/h4-9,11-14H,10,15-20H2,1-3H3 |
| InChIKey | MRIXKETUVDJJRS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|