C25H37NO3Si — CID 167364784
methyl 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl-ethylamino]butanoate (PubChem CID 167364784) has the molecular formula C25H37NO3Si and a molecular weight of 427.66 g/mol. Its IUPAC name is methyl 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl-ethylamino]butanoate.
| Compound Name | methyl 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl-ethylamino]butanoate |
|---|---|
| PubChem CID | 167364784 |
| Molecular Formula | C25H37NO3Si |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | methyl 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl-ethylamino]butanoate |
| SMILES | CCN(CCCC(=O)OC)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H37NO3Si/c1-6-26(19-13-18-24(27)28-5)20-21-29-30(25(2,3)4,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17H,6,13,18-21H2,1-5H3 |
| InChIKey | VLKARPARALLUMC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|