C29H60O3SiSn — CID 10769935
[4-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]-2-methylidenebutyl]-trimethylsilane (PubChem CID 10769935) has the molecular formula C29H60O3SiSn and a molecular weight of 603.59 g/mol. Its IUPAC name is [4-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]-2-methylidenebutyl]-trimethylsilane.
| Compound Name | [4-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]-2-methylidenebutyl]-trimethylsilane |
|---|---|
| PubChem CID | 10769935 |
| Molecular Formula | C29H60O3SiSn |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | [4-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]-2-methylidenebutyl]-trimethylsilane |
| SMILES | C=C(CCOC(CCCC1COC(C)(C)O1)[Sn](CCCC)(CCCC)CCCC)C[Si](C)(C)C |
| InChI | InChI=1S/C17H33O3Si.3C4H9.Sn/c1-15(14-21(4,5)6)10-12-18-11-8-7-9-16-13-19-17(2,3)20-16;3*1-3-4-2;/h11,16H,1,7-10,12-14H2,2-6H3;3*1,3-4H2,2H3; |
| InChIKey | LMBONPHXOLSLML-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|