C29H60O3SiSn — CID 10531694
[(Z)-5-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]pent-2-enyl]-trimethylsilane (PubChem CID 10531694) has the molecular formula C29H60O3SiSn and a molecular weight of 603.59 g/mol. Its IUPAC name is [(Z)-5-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]pent-2-enyl]-trimethylsilane.
| Compound Name | [(Z)-5-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]pent-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 10531694 |
| Molecular Formula | C29H60O3SiSn |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | [(Z)-5-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]pent-2-enyl]-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(CCCC1COC(C)(C)O1)OCC/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C17H33O3Si.3C4H9.Sn/c1-17(2)19-15-16(20-17)11-7-9-13-18-12-8-6-10-14-21(3,4)5;3*1-3-4-2;/h6,10,13,16H,7-9,11-12,14-15H2,1-5H3;3*1,3-4H2,2H3;/b10-6-;;;; |
| InChIKey | OVCBIMYLGGUYBD-GBSMHVDXSA-N |
| XLogP | 9.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|