C34H59NO7Si — CID 10770192
(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[(2S,3R)-3-hydroxy-2-methyldecanoyl]oxy-3-methylbutanoyl]-methylamino]-5-phenylpentanoic acid (PubChem CID 10770192) has the molecular formula C34H59NO7Si and a molecular weight of 621.93 g/mol. Its IUPAC name is (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[(2S,3R)-3-hydroxy-2-methyldecanoyl]oxy-3-methylbutanoyl]-methylamino]-5-phenylpentanoic acid.
| Compound Name | (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[(2S,3R)-3-hydroxy-2-methyldecanoyl]oxy-3-methylbutanoyl]-methylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 10770192 |
| Molecular Formula | C34H59NO7Si |
| Molecular Weight | 621.93 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[(2S)-2-[(2S,3R)-3-hydroxy-2-methyldecanoyl]oxy-3-methylbutanoyl]-methylamino]-5-phenylpentanoic acid |
| SMILES | CCCCCCC[C@@H](O)[C@H](C)C(=O)O[C@H](C(=O)N(C)[C@@H](Cc1ccccc1)[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C34H59NO7Si/c1-11-12-13-14-18-21-28(36)25(4)33(40)41-31(24(2)3)32(39)35(8)27(22-26-19-16-15-17-20-26)29(23-30(37)38)42-43(9,10)34(5,6)7/h15-17,19-20,24-25,27-29,31,36H,11-14,18,21-23H2,1-10H3,(H,37,38)/t25-,27-,28+,29+,31-/m0/s1 |
| InChIKey | NCWQHXAWNCFUOJ-PHURAUOSSA-N |
| XLogP | 6.85 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.93 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|