C35H39NO10 — CID 10770327
2-O-(diethylamino) 3-O-methyl 4-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-1-phenylmethoxynaphthalene-2,3-dicarboxylate (PubChem CID 10770327) has the molecular formula C35H39NO10 and a molecular weight of 633.69 g/mol. Its IUPAC name is 2-O-(diethylamino) 3-O-methyl 4-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-1-phenylmethoxynaphthalene-2,3-dicarboxylate.
| Compound Name | 2-O-(diethylamino) 3-O-methyl 4-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-1-phenylmethoxynaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10770327 |
| Molecular Formula | C35H39NO10 |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | 2-O-(diethylamino) 3-O-methyl 4-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-1-phenylmethoxynaphthalene-2,3-dicarboxylate |
| SMILES | CCN(CC)OC(=O)c1c(C(=O)OC)c(-c2ccc(OC)c(OC)c2)c2c(OC)c(OC)c(OC)cc2c1OCc1ccccc1 |
| InChI | InChI=1S/C35H39NO10/c1-9-36(10-2)46-35(38)30-29(34(37)44-8)27(22-16-17-24(39-3)25(18-22)40-4)28-23(19-26(41-5)32(42-6)33(28)43-7)31(30)45-20-21-14-12-11-13-15-21/h11-19H,9-10,20H2,1-8H3 |
| InChIKey | PAMPCIRJAMRLQO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|