C24H22O10 — CID 19688728
8-(3,4-dimethoxyphenyl)-7-methoxycarbonyl-5-(methoxymethoxy)benzo[f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 19688728) has the molecular formula C24H22O10 and a molecular weight of 470.43 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-7-methoxycarbonyl-5-(methoxymethoxy)benzo[f][1,3]benzodioxole-6-carboxylic acid.
| Compound Name | 8-(3,4-dimethoxyphenyl)-7-methoxycarbonyl-5-(methoxymethoxy)benzo[f][1,3]benzodioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 19688728 |
| Molecular Formula | C24H22O10 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-7-methoxycarbonyl-5-(methoxymethoxy)benzo[f][1,3]benzodioxole-6-carboxylic acid |
| SMILES | COCOc1c(C(=O)O)c(C(=O)OC)c(-c2ccc(OC)c(OC)c2)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C24H22O10/c1-28-10-34-22-14-9-18-17(32-11-33-18)8-13(14)19(20(24(27)31-4)21(22)23(25)26)12-5-6-15(29-2)16(7-12)30-3/h5-9H,10-11H2,1-4H3,(H,25,26) |
| InChIKey | UYYYZHMZKOCSSH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|