C12H20N2O2 — CID 107705108
3-(6-hydroxyhexyl)-2,6-dimethylpyrimidin-4-one (PubChem CID 107705108) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(6-hydroxyhexyl)-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-(6-hydroxyhexyl)-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 107705108 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-(6-hydroxyhexyl)-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(CCCCCCO)c(C)n1 |
| InChI | InChI=1S/C12H20N2O2/c1-10-9-12(16)14(11(2)13-10)7-5-3-4-6-8-15/h9,15H,3-8H2,1-2H3 |
| InChIKey | IVEQGNLWGCSCSD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|