C13H27N5OS — CID 107707232
6-[1-[2-(tert-butylamino)ethyl]tetrazol-5-yl]sulfanylhexan-1-ol (PubChem CID 107707232) has the molecular formula C13H27N5OS and a molecular weight of 301.46 g/mol. Its IUPAC name is 6-[1-[2-(tert-butylamino)ethyl]tetrazol-5-yl]sulfanylhexan-1-ol.
| Compound Name | 6-[1-[2-(tert-butylamino)ethyl]tetrazol-5-yl]sulfanylhexan-1-ol |
|---|---|
| PubChem CID | 107707232 |
| Molecular Formula | C13H27N5OS |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 6-[1-[2-(tert-butylamino)ethyl]tetrazol-5-yl]sulfanylhexan-1-ol |
| SMILES | CC(C)(C)NCCn1nnnc1SCCCCCCO |
| InChI | InChI=1S/C13H27N5OS/c1-13(2,3)14-8-9-18-12(15-16-17-18)20-11-7-5-4-6-10-19/h14,19H,4-11H2,1-3H3 |
| InChIKey | PFEXZPDAKOSQJS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|