C13H25N5OS — CID 103140437
2-methyl-N-[2-[5-[(5-methyloxolan-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine (PubChem CID 103140437) has the molecular formula C13H25N5OS and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-methyl-N-[2-[5-[(5-methyloxolan-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-[5-[(5-methyloxolan-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 103140437 |
| Molecular Formula | C13H25N5OS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-methyl-N-[2-[5-[(5-methyloxolan-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine |
| SMILES | CC1CCC(CSc2nnnn2CCNC(C)(C)C)O1 |
| InChI | InChI=1S/C13H25N5OS/c1-10-5-6-11(19-10)9-20-12-15-16-17-18(12)8-7-14-13(2,3)4/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | JDGOGHDZGOVCBE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |