C12H21N7S — CID 82870865
2-methyl-N-[2-[5-[(1-methylpyrazol-3-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine (PubChem CID 82870865) has the molecular formula C12H21N7S and a molecular weight of 295.42 g/mol. Its IUPAC name is 2-methyl-N-[2-[5-[(1-methylpyrazol-3-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-[5-[(1-methylpyrazol-3-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 82870865 |
| Molecular Formula | C12H21N7S |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-methyl-N-[2-[5-[(1-methylpyrazol-3-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-2-amine |
| SMILES | Cn1ccc(CSc2nnnn2CCNC(C)(C)C)n1 |
| InChI | InChI=1S/C12H21N7S/c1-12(2,3)13-6-8-19-11(14-16-17-19)20-9-10-5-7-18(4)15-10/h5,7,13H,6,8-9H2,1-4H3 |
| InChIKey | DZYZYCUKWMOIOP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |