C13H26N6OS — CID 79172516
2-methyl-N-[2-[5-[(4-methylmorpholin-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-1-amine (PubChem CID 79172516) has the molecular formula C13H26N6OS and a molecular weight of 314.46 g/mol. Its IUPAC name is 2-methyl-N-[2-[5-[(4-methylmorpholin-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-1-amine.
| Compound Name | 2-methyl-N-[2-[5-[(4-methylmorpholin-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79172516 |
| Molecular Formula | C13H26N6OS |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 2-methyl-N-[2-[5-[(4-methylmorpholin-2-yl)methylsulfanyl]tetrazol-1-yl]ethyl]propan-1-amine |
| SMILES | CC(C)CNCCn1nnnc1SCC1CN(C)CCO1 |
| InChI | InChI=1S/C13H26N6OS/c1-11(2)8-14-4-5-19-13(15-16-17-19)21-10-12-9-18(3)6-7-20-12/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | AINFWBCOPKMVIG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|