C34H30N3O5+ — CID 10770880
dimethyl 4-(5-phenanthridin-5-ium-5-ylpentoxy)-1,10-phenanthroline-2,9-dicarboxylate (PubChem CID 10770880) has the molecular formula C34H30N3O5+ and a molecular weight of 560.63 g/mol. Its IUPAC name is dimethyl 4-(5-phenanthridin-5-ium-5-ylpentoxy)-1,10-phenanthroline-2,9-dicarboxylate.
| Compound Name | dimethyl 4-(5-phenanthridin-5-ium-5-ylpentoxy)-1,10-phenanthroline-2,9-dicarboxylate |
|---|---|
| PubChem CID | 10770880 |
| Molecular Formula | C34H30N3O5+ |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | dimethyl 4-(5-phenanthridin-5-ium-5-ylpentoxy)-1,10-phenanthroline-2,9-dicarboxylate |
| SMILES | COC(=O)c1ccc2ccc3c(OCCCCC[n+]4cc5ccccc5c5ccccc54)cc(C(=O)OC)nc3c2n1 |
| InChI | InChI=1S/C34H30N3O5/c1-40-33(38)27-17-15-22-14-16-26-30(20-28(34(39)41-2)36-32(26)31(22)35-27)42-19-9-3-8-18-37-21-23-10-4-5-11-24(23)25-12-6-7-13-29(25)37/h4-7,10-17,20-21H,3,8-9,18-19H2,1-2H3/q+1 |
| InChIKey | GDXKOLIKXJFTEZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|