About [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine
[5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine (PubChem CID 107727403) has the molecular formula C12H12Br2N4O
and a molecular weight of 388.06 g/mol. Its IUPAC name is [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine |
| PubChem CID | 107727403 |
| Molecular Formula | C12H12Br2N4O |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(Oc2nc(NN)ncc2Br)cc(C)c1Br |
| InChI | InChI=1S/C12H12Br2N4O/c1-6-3-8(4-7(2)10(6)14)19-11-9(13)5-16-12(17-11)18-15/h3-5H,15H2,1-2H3,(H,16,17,18) |
| InChIKey | VERVCWVBQLYAES-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine?
The IUPAC name of [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine (CID 107727403) is [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine.
What is the SMILES notation for [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine?
The canonical SMILES for [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine is Cc1cc(Oc2nc(NN)ncc2Br)cc(C)c1Br.
What is the InChIKey of [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine?
The InChIKey is VERVCWVBQLYAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Br2N4O/c1-6-3-8(4-7(2)10(6)14)19-11-9(13)5-16-12(17-11)18-15/h3-5H,15H2,1-2H3,(H,16,17,18).
What are the key properties of [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine?
[5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine has a molecular weight of 388.06 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-bromo-4-(4-bromo-3,5-dimethylphenoxy)pyrimidin-2-yl]hydrazine is sourced from PubChem (CID 107727403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).