C16H15BrN2O2 — CID 107730011
(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-bromo-2-hydroxyphenyl)methanone (PubChem CID 107730011) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-bromo-2-hydroxyphenyl)methanone.
| Compound Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-bromo-2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107730011 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(5-bromo-2-hydroxyphenyl)methanone |
| SMILES | Nc1cccc2c1CN(C(=O)c1cc(Br)ccc1O)CC2 |
| InChI | InChI=1S/C16H15BrN2O2/c17-11-4-5-15(20)12(8-11)16(21)19-7-6-10-2-1-3-14(18)13(10)9-19/h1-5,8,20H,6-7,9,18H2 |
| InChIKey | MIBFZJJRIWDJQG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|