About 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole
6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 10773333) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
Analyze 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The IUPAC name of 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole (CID 10773333) is 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
What is the SMILES notation for 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The canonical SMILES for 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole is CCCc1nc2cc(C)[nH]n2n1.
What is the InChIKey of 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The InChIKey is YXRAEXLXAALZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-3-4-7-9-8-5-6(2)10-12(8)11-7/h5,10H,3-4H2,1-2H3.
What are the key properties of 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole has a molecular weight of 164.21 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-propyl-5H-pyrazolo[1,5-b][1,2,4]triazole is sourced from PubChem (CID 10773333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).