C13H12ClFN2O3S — CID 107733489
3-amino-5-chloro-2-fluoro-N-(3-hydroxyphenyl)-N-methylbenzenesulfonamide (PubChem CID 107733489) has the molecular formula C13H12ClFN2O3S and a molecular weight of 330.77 g/mol. Its IUPAC name is 3-amino-5-chloro-2-fluoro-N-(3-hydroxyphenyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-fluoro-N-(3-hydroxyphenyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107733489 |
| Molecular Formula | C13H12ClFN2O3S |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 3-amino-5-chloro-2-fluoro-N-(3-hydroxyphenyl)-N-methylbenzenesulfonamide |
| SMILES | CN(c1cccc(O)c1)S(=O)(=O)c1cc(Cl)cc(N)c1F |
| InChI | InChI=1S/C13H12ClFN2O3S/c1-17(9-3-2-4-10(18)7-9)21(19,20)12-6-8(14)5-11(16)13(12)15/h2-7,18H,16H2,1H3 |
| InChIKey | GKAKYCBYWBJXPD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|