C15H18N2O3S — CID 107733521
3-amino-N-(3-hydroxyphenyl)-N,2,6-trimethylbenzenesulfonamide (PubChem CID 107733521) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-amino-N-(3-hydroxyphenyl)-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(3-hydroxyphenyl)-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107733521 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-amino-N-(3-hydroxyphenyl)-N,2,6-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(N)c(C)c1S(=O)(=O)N(C)c1cccc(O)c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-10-7-8-14(16)11(2)15(10)21(19,20)17(3)12-5-4-6-13(18)9-12/h4-9,18H,16H2,1-3H3 |
| InChIKey | RQIIYHKJZYFMEB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|