C14H18Br2O4S — CID 107738776
[3,5-dibromo-4-(3-methylsulfonylcyclohexyl)oxyphenyl]methanol (PubChem CID 107738776) has the molecular formula C14H18Br2O4S and a molecular weight of 442.17 g/mol. Its IUPAC name is [3,5-dibromo-4-(3-methylsulfonylcyclohexyl)oxyphenyl]methanol.
| Compound Name | [3,5-dibromo-4-(3-methylsulfonylcyclohexyl)oxyphenyl]methanol |
|---|---|
| PubChem CID | 107738776 |
| Molecular Formula | C14H18Br2O4S |
| Molecular Weight | 442.17 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | [3,5-dibromo-4-(3-methylsulfonylcyclohexyl)oxyphenyl]methanol |
| SMILES | CS(=O)(=O)C1CCCC(Oc2c(Br)cc(CO)cc2Br)C1 |
| InChI | InChI=1S/C14H18Br2O4S/c1-21(18,19)11-4-2-3-10(7-11)20-14-12(15)5-9(8-17)6-13(14)16/h5-6,10-11,17H,2-4,7-8H2,1H3 |
| InChIKey | WQUVIRCZVQNXKX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.17 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |