C15H16Br2N2O2 — CID 107741788
1-[2-[2,6-dibromo-4-(methylaminomethyl)phenoxy]ethyl]pyridin-2-one (PubChem CID 107741788) has the molecular formula C15H16Br2N2O2 and a molecular weight of 416.11 g/mol. Its IUPAC name is 1-[2-[2,6-dibromo-4-(methylaminomethyl)phenoxy]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[2,6-dibromo-4-(methylaminomethyl)phenoxy]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 107741788 |
| Molecular Formula | C15H16Br2N2O2 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 1-[2-[2,6-dibromo-4-(methylaminomethyl)phenoxy]ethyl]pyridin-2-one |
| SMILES | CNCc1cc(Br)c(OCCn2ccccc2=O)c(Br)c1 |
| InChI | InChI=1S/C15H16Br2N2O2/c1-18-10-11-8-12(16)15(13(17)9-11)21-7-6-19-5-3-2-4-14(19)20/h2-5,8-9,18H,6-7,10H2,1H3 |
| InChIKey | LQBFLBMNUPWGKA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |