C16H17NO3 — CID 82896972
3,5-dimethyl-4-[2-(2-oxo-1-pyridinyl)ethoxy]benzaldehyde (PubChem CID 82896972) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-(2-oxo-1-pyridinyl)ethoxy]benzaldehyde.
| Compound Name | 3,5-dimethyl-4-[2-(2-oxo-1-pyridinyl)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 82896972 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3,5-dimethyl-4-[2-(2-oxo-1-pyridinyl)ethoxy]benzaldehyde |
| SMILES | Cc1cc(C=O)cc(C)c1OCCn1ccccc1=O |
| InChI | InChI=1S/C16H17NO3/c1-12-9-14(11-18)10-13(2)16(12)20-8-7-17-6-4-3-5-15(17)19/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | OCGZHIOFPROICZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|