C13H12Br2N2O2 — CID 82897267
1-[2-(4-amino-2,6-dibromophenoxy)ethyl]pyridin-2-one (PubChem CID 82897267) has the molecular formula C13H12Br2N2O2 and a molecular weight of 388.06 g/mol. Its IUPAC name is 1-[2-(4-amino-2,6-dibromophenoxy)ethyl]pyridin-2-one.
| Compound Name | 1-[2-(4-amino-2,6-dibromophenoxy)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 82897267 |
| Molecular Formula | C13H12Br2N2O2 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 1-[2-(4-amino-2,6-dibromophenoxy)ethyl]pyridin-2-one |
| SMILES | Nc1cc(Br)c(OCCn2ccccc2=O)c(Br)c1 |
| InChI | InChI=1S/C13H12Br2N2O2/c14-10-7-9(16)8-11(15)13(10)19-6-5-17-4-2-1-3-12(17)18/h1-4,7-8H,5-6,16H2 |
| InChIKey | BQYLNANNWPZTTB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|