C16H24N2OS — CID 107750805
6-(2-methylbutylsulfanyl)-3-(propylamino)-1,3-dihydroindol-2-one (PubChem CID 107750805) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 6-(2-methylbutylsulfanyl)-3-(propylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-(2-methylbutylsulfanyl)-3-(propylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 107750805 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 6-(2-methylbutylsulfanyl)-3-(propylamino)-1,3-dihydroindol-2-one |
| SMILES | CCCNC1C(=O)Nc2cc(SCC(C)CC)ccc21 |
| InChI | InChI=1S/C16H24N2OS/c1-4-8-17-15-13-7-6-12(20-10-11(3)5-2)9-14(13)18-16(15)19/h6-7,9,11,15,17H,4-5,8,10H2,1-3H3,(H,18,19) |
| InChIKey | ZACWUZMXHRYFOX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |