C15H17N5O — CID 43586576
2-[cyanomethyl-[2-oxo-3-(propylamino)-1,3-dihydroindol-6-yl]amino]acetonitrile (PubChem CID 43586576) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-[cyanomethyl-[2-oxo-3-(propylamino)-1,3-dihydroindol-6-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[2-oxo-3-(propylamino)-1,3-dihydroindol-6-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 43586576 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[cyanomethyl-[2-oxo-3-(propylamino)-1,3-dihydroindol-6-yl]amino]acetonitrile |
| SMILES | CCCNC1C(=O)Nc2cc(N(CC#N)CC#N)ccc21 |
| InChI | InChI=1S/C15H17N5O/c1-2-7-18-14-12-4-3-11(10-13(12)19-15(14)21)20(8-5-16)9-6-17/h3-4,10,14,18H,2,7-9H2,1H3,(H,19,21) |
| InChIKey | DXPSLHUCHGJYHP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|