C10H13ClN4S — CID 107751341
2-chloro-6-(3-methylbutylsulfanyl)-7H-purine (PubChem CID 107751341) has the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. Its IUPAC name is 2-chloro-6-(3-methylbutylsulfanyl)-7H-purine.
| Compound Name | 2-chloro-6-(3-methylbutylsulfanyl)-7H-purine |
|---|---|
| PubChem CID | 107751341 |
| Molecular Formula | C10H13ClN4S |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-chloro-6-(3-methylbutylsulfanyl)-7H-purine |
| SMILES | CC(C)CCSc1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H13ClN4S/c1-6(2)3-4-16-9-7-8(13-5-12-7)14-10(11)15-9/h5-6H,3-4H2,1-2H3,(H,12,13,14,15) |
| InChIKey | GRDSAKZAXOLNRO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |