C9H6ClN5S2 — CID 104787517
2-[(2-chloro-7H-purin-6-yl)sulfanyl]-4-methyl-1,3-thiazole (PubChem CID 104787517) has the molecular formula C9H6ClN5S2 and a molecular weight of 283.77 g/mol. Its IUPAC name is 2-[(2-chloro-7H-purin-6-yl)sulfanyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[(2-chloro-7H-purin-6-yl)sulfanyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 104787517 |
| Molecular Formula | C9H6ClN5S2 |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-[(2-chloro-7H-purin-6-yl)sulfanyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(Sc2nc(Cl)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C9H6ClN5S2/c1-4-2-16-9(13-4)17-7-5-6(12-3-11-5)14-8(10)15-7/h2-3H,1H3,(H,11,12,14,15) |
| InChIKey | SKUGPXSYHQPPHI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |