C14H23NO2S2 — CID 107752285
[3-[2-(2-methylbutylsulfanyl)ethylsulfonyl]phenyl]methanamine (PubChem CID 107752285) has the molecular formula C14H23NO2S2 and a molecular weight of 301.48 g/mol. Its IUPAC name is [3-[2-(2-methylbutylsulfanyl)ethylsulfonyl]phenyl]methanamine.
| Compound Name | [3-[2-(2-methylbutylsulfanyl)ethylsulfonyl]phenyl]methanamine |
|---|---|
| PubChem CID | 107752285 |
| Molecular Formula | C14H23NO2S2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [3-[2-(2-methylbutylsulfanyl)ethylsulfonyl]phenyl]methanamine |
| SMILES | CCC(C)CSCCS(=O)(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C14H23NO2S2/c1-3-12(2)11-18-7-8-19(16,17)14-6-4-5-13(9-14)10-15/h4-6,9,12H,3,7-8,10-11,15H2,1-2H3 |
| InChIKey | HFDJCXLGCXDVPJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|