C12H14N2O3S2 — CID 106923783
[3-[2-(1,3-oxazol-2-ylsulfanyl)ethylsulfonyl]phenyl]methanamine (PubChem CID 106923783) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is [3-[2-(1,3-oxazol-2-ylsulfanyl)ethylsulfonyl]phenyl]methanamine.
| Compound Name | [3-[2-(1,3-oxazol-2-ylsulfanyl)ethylsulfonyl]phenyl]methanamine |
|---|---|
| PubChem CID | 106923783 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | [3-[2-(1,3-oxazol-2-ylsulfanyl)ethylsulfonyl]phenyl]methanamine |
| SMILES | NCc1cccc(S(=O)(=O)CCSc2ncco2)c1 |
| InChI | InChI=1S/C12H14N2O3S2/c13-9-10-2-1-3-11(8-10)19(15,16)7-6-18-12-14-4-5-17-12/h1-5,8H,6-7,9,13H2 |
| InChIKey | LMOKYTWMEMCZPF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |