C10H13F2NO2S — CID 84706979
[3-(2,2-difluoropropylsulfonyl)phenyl]methanamine (PubChem CID 84706979) has the molecular formula C10H13F2NO2S and a molecular weight of 249.28 g/mol. Its IUPAC name is [3-(2,2-difluoropropylsulfonyl)phenyl]methanamine.
| Compound Name | [3-(2,2-difluoropropylsulfonyl)phenyl]methanamine |
|---|---|
| PubChem CID | 84706979 |
| Molecular Formula | C10H13F2NO2S |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [3-(2,2-difluoropropylsulfonyl)phenyl]methanamine |
| SMILES | CC(F)(F)CS(=O)(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C10H13F2NO2S/c1-10(11,12)7-16(14,15)9-4-2-3-8(5-9)6-13/h2-5H,6-7,13H2,1H3 |
| InChIKey | KIWMNHWSGWCKSG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |