C10H7NO5 — CID 10775330
(2,4-dioxo-1H-3,1-benzoxazin-8-yl) acetate (PubChem CID 10775330) has the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. Its IUPAC name is (2,4-dioxo-1H-3,1-benzoxazin-8-yl) acetate.
| Compound Name | (2,4-dioxo-1H-3,1-benzoxazin-8-yl) acetate |
|---|---|
| PubChem CID | 10775330 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (2,4-dioxo-1H-3,1-benzoxazin-8-yl) acetate |
| SMILES | CC(=O)Oc1cccc2c(=O)oc(=O)[nH]c12 |
| InChI | InChI=1S/C10H7NO5/c1-5(12)15-7-4-2-3-6-8(7)11-10(14)16-9(6)13/h2-4H,1H3,(H,11,14) |
| InChIKey | LMVLHTQJBQRKHM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|