C20H14O8 — CID 19929557
(3,8-diacetyloxy-2-oxochromen-4-yl) benzoate (PubChem CID 19929557) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is (3,8-diacetyloxy-2-oxochromen-4-yl) benzoate.
| Compound Name | (3,8-diacetyloxy-2-oxochromen-4-yl) benzoate |
|---|---|
| PubChem CID | 19929557 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (3,8-diacetyloxy-2-oxochromen-4-yl) benzoate |
| SMILES | CC(=O)Oc1c(OC(=O)c2ccccc2)c2cccc(OC(C)=O)c2oc1=O |
| InChI | InChI=1S/C20H14O8/c1-11(21)25-15-10-6-9-14-16(15)27-20(24)18(26-12(2)22)17(14)28-19(23)13-7-4-3-5-8-13/h3-10H,1-2H3 |
| InChIKey | FZMGOPFBXOEMRY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|