C22H22O4 — CID 19929355
[2-oxo-3,8-di(propan-2-yl)chromen-4-yl] benzoate (PubChem CID 19929355) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is [2-oxo-3,8-di(propan-2-yl)chromen-4-yl] benzoate.
| Compound Name | [2-oxo-3,8-di(propan-2-yl)chromen-4-yl] benzoate |
|---|---|
| PubChem CID | 19929355 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [2-oxo-3,8-di(propan-2-yl)chromen-4-yl] benzoate |
| SMILES | CC(C)c1c(OC(=O)c2ccccc2)c2cccc(C(C)C)c2oc1=O |
| InChI | InChI=1S/C22H22O4/c1-13(2)16-11-8-12-17-19(16)25-22(24)18(14(3)4)20(17)26-21(23)15-9-6-5-7-10-15/h5-14H,1-4H3 |
| InChIKey | IZZMWZUDENERQM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|