C12H16BrNO2S — CID 107753508
2-bromo-5-[(2-methyloxolan-3-yl)sulfinylmethyl]aniline (PubChem CID 107753508) has the molecular formula C12H16BrNO2S and a molecular weight of 318.24 g/mol. Its IUPAC name is 2-bromo-5-[(2-methyloxolan-3-yl)sulfinylmethyl]aniline.
| Compound Name | 2-bromo-5-[(2-methyloxolan-3-yl)sulfinylmethyl]aniline |
|---|---|
| PubChem CID | 107753508 |
| Molecular Formula | C12H16BrNO2S |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 2-bromo-5-[(2-methyloxolan-3-yl)sulfinylmethyl]aniline |
| SMILES | CC1OCCC1S(=O)Cc1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C12H16BrNO2S/c1-8-12(4-5-16-8)17(15)7-9-2-3-10(13)11(14)6-9/h2-3,6,8,12H,4-5,7,14H2,1H3 |
| InChIKey | MUNQJHWZOBOVCU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|