C11H14O4S — CID 107764333
1-(furan-2-yl)-2-(2-methyloxolan-3-yl)sulfinylethanone (PubChem CID 107764333) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(2-methyloxolan-3-yl)sulfinylethanone.
| Compound Name | 1-(furan-2-yl)-2-(2-methyloxolan-3-yl)sulfinylethanone |
|---|---|
| PubChem CID | 107764333 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-(furan-2-yl)-2-(2-methyloxolan-3-yl)sulfinylethanone |
| SMILES | CC1OCCC1S(=O)CC(=O)c1ccco1 |
| InChI | InChI=1S/C11H14O4S/c1-8-11(4-6-14-8)16(13)7-9(12)10-3-2-5-15-10/h2-3,5,8,11H,4,6-7H2,1H3 |
| InChIKey | MXDOAUBBTDXDFP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |