C15H20N2OS — CID 107754807
2-amino-4-(2-methyloxolan-3-yl)sulfanyl-2-phenylbutanenitrile (PubChem CID 107754807) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-amino-4-(2-methyloxolan-3-yl)sulfanyl-2-phenylbutanenitrile.
| Compound Name | 2-amino-4-(2-methyloxolan-3-yl)sulfanyl-2-phenylbutanenitrile |
|---|---|
| PubChem CID | 107754807 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-amino-4-(2-methyloxolan-3-yl)sulfanyl-2-phenylbutanenitrile |
| SMILES | CC1OCCC1SCCC(N)(C#N)c1ccccc1 |
| InChI | InChI=1S/C15H20N2OS/c1-12-14(7-9-18-12)19-10-8-15(17,11-16)13-5-3-2-4-6-13/h2-6,12,14H,7-10,17H2,1H3 |
| InChIKey | CHPXXMGHPUQVIH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |