C14H20N2OS — CID 116693415
2-amino-4-(3-hydroxy-2-methylpropyl)sulfanyl-2-phenylbutanenitrile (PubChem CID 116693415) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-amino-4-(3-hydroxy-2-methylpropyl)sulfanyl-2-phenylbutanenitrile.
| Compound Name | 2-amino-4-(3-hydroxy-2-methylpropyl)sulfanyl-2-phenylbutanenitrile |
|---|---|
| PubChem CID | 116693415 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-amino-4-(3-hydroxy-2-methylpropyl)sulfanyl-2-phenylbutanenitrile |
| SMILES | CC(CO)CSCCC(N)(C#N)c1ccccc1 |
| InChI | InChI=1S/C14H20N2OS/c1-12(9-17)10-18-8-7-14(16,11-15)13-5-3-2-4-6-13/h2-6,12,17H,7-10,16H2,1H3 |
| InChIKey | BEKVKDXBSDZTFZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|