C11H17ClN2S — CID 107756582
5-chloro-6-(2-methylbutylsulfanylmethyl)pyridin-2-amine (PubChem CID 107756582) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 5-chloro-6-(2-methylbutylsulfanylmethyl)pyridin-2-amine.
| Compound Name | 5-chloro-6-(2-methylbutylsulfanylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107756582 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-chloro-6-(2-methylbutylsulfanylmethyl)pyridin-2-amine |
| SMILES | CCC(C)CSCc1nc(N)ccc1Cl |
| InChI | InChI=1S/C11H17ClN2S/c1-3-8(2)6-15-7-10-9(12)4-5-11(13)14-10/h4-5,8H,3,6-7H2,1-2H3,(H2,13,14) |
| InChIKey | RAWXPLLGSVHUTK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |