C10H16ClN3S — CID 62885804
[5-chloro-6-(2-methylpropylsulfanylmethyl)-2-pyridinyl]hydrazine (PubChem CID 62885804) has the molecular formula C10H16ClN3S and a molecular weight of 245.78 g/mol. Its IUPAC name is [5-chloro-6-(2-methylpropylsulfanylmethyl)-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-(2-methylpropylsulfanylmethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62885804 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | [5-chloro-6-(2-methylpropylsulfanylmethyl)-2-pyridinyl]hydrazine |
| SMILES | CC(C)CSCc1nc(NN)ccc1Cl |
| InChI | InChI=1S/C10H16ClN3S/c1-7(2)5-15-6-9-8(11)3-4-10(13-9)14-12/h3-4,7H,5-6,12H2,1-2H3,(H,13,14) |
| InChIKey | PUCDMQIHZMHGEY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|