C8H8ClN5S2 — CID 62887225
[5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine (PubChem CID 62887225) has the molecular formula C8H8ClN5S2 and a molecular weight of 273.77 g/mol. Its IUPAC name is [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine.
| Compound Name | [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62887225 |
| Molecular Formula | C8H8ClN5S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(CSc2nncs2)n1 |
| InChI | InChI=1S/C8H8ClN5S2/c9-5-1-2-7(13-10)12-6(5)3-15-8-14-11-4-16-8/h1-2,4H,3,10H2,(H,12,13) |
| InChIKey | KAKPDNCVHDFPRO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|