About [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine
[5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine (PubChem CID 62887225) has the molecular formula C8H8ClN5S2
and a molecular weight of 273.77 g/mol. Its IUPAC name is [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine |
| PubChem CID | 62887225 |
| Molecular Formula | C8H8ClN5S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(CSc2nncs2)n1 |
| InChI | InChI=1S/C8H8ClN5S2/c9-5-1-2-7(13-10)12-6(5)3-15-8-14-11-4-16-8/h1-2,4H,3,10H2,(H,12,13) |
| InChIKey | KAKPDNCVHDFPRO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine?
The IUPAC name of [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine (CID 62887225) is [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine?
The canonical SMILES for [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine is NNc1ccc(Cl)c(CSc2nncs2)n1.
What is the InChIKey of [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine?
The InChIKey is KAKPDNCVHDFPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN5S2/c9-5-1-2-7(13-10)12-6(5)3-15-8-14-11-4-16-8/h1-2,4H,3,10H2,(H,12,13).
What are the key properties of [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine?
[5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine has a molecular weight of 273.77 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-6-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 62887225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).