C11H18N2S — CID 107756692
2-(3-methylbutylsulfanylmethyl)pyridin-4-amine (PubChem CID 107756692) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2-(3-methylbutylsulfanylmethyl)pyridin-4-amine.
| Compound Name | 2-(3-methylbutylsulfanylmethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 107756692 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(3-methylbutylsulfanylmethyl)pyridin-4-amine |
| SMILES | CC(C)CCSCc1cc(N)ccn1 |
| InChI | InChI=1S/C11H18N2S/c1-9(2)4-6-14-8-11-7-10(12)3-5-13-11/h3,5,7,9H,4,6,8H2,1-2H3,(H2,12,13) |
| InChIKey | MXPVZIUDQDRLEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|