C10H20N2O2S — CID 107760901
3-methyl-2-(2-methyloxolan-3-yl)sulfanylbutanehydrazide (PubChem CID 107760901) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-methyl-2-(2-methyloxolan-3-yl)sulfanylbutanehydrazide.
| Compound Name | 3-methyl-2-(2-methyloxolan-3-yl)sulfanylbutanehydrazide |
|---|---|
| PubChem CID | 107760901 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-methyl-2-(2-methyloxolan-3-yl)sulfanylbutanehydrazide |
| SMILES | CC(C)C(SC1CCOC1C)C(=O)NN |
| InChI | InChI=1S/C10H20N2O2S/c1-6(2)9(10(13)12-11)15-8-4-5-14-7(8)3/h6-9H,4-5,11H2,1-3H3,(H,12,13) |
| InChIKey | AWUDERXZERDGNM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|