C13H14N2OS — CID 10776832
methyl (2E)-N-(4,6-dimethyl-2-pyridinyl)furan-2-carboximidothioate (PubChem CID 10776832) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is methyl (2E)-N-(4,6-dimethyl-2-pyridinyl)furan-2-carboximidothioate.
| Compound Name | methyl (2E)-N-(4,6-dimethyl-2-pyridinyl)furan-2-carboximidothioate |
|---|---|
| PubChem CID | 10776832 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | methyl (2E)-N-(4,6-dimethyl-2-pyridinyl)furan-2-carboximidothioate |
| SMILES | CS/C(=N/c1cc(C)cc(C)n1)c1ccco1 |
| InChI | InChI=1S/C13H14N2OS/c1-9-7-10(2)14-12(8-9)15-13(17-3)11-5-4-6-16-11/h4-8H,1-3H3/b15-13+ |
| InChIKey | CKRSBGGGNHURFR-FYWRMAATSA-N |
| XLogP | 3.73 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|