C11H18BrNOS2 — CID 107770488
3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylbutan-2-ol (PubChem CID 107770488) has the molecular formula C11H18BrNOS2 and a molecular weight of 324.31 g/mol. Its IUPAC name is 3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylbutan-2-ol.
| Compound Name | 3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107770488 |
| Molecular Formula | C11H18BrNOS2 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylbutan-2-ol |
| SMILES | CC(N)C(SC(C)C(C)O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H18BrNOS2/c1-6(13)11(15-8(3)7(2)14)9-4-5-10(12)16-9/h4-8,11,14H,13H2,1-3H3 |
| InChIKey | FOCSFDLVQTYGAV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |