C10H16BrNOS2 — CID 66115909
3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylpropan-1-ol (PubChem CID 66115909) has the molecular formula C10H16BrNOS2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylpropan-1-ol.
| Compound Name | 3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 66115909 |
| Molecular Formula | C10H16BrNOS2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 3-[2-amino-1-(5-bromothiophen-2-yl)propyl]sulfanylpropan-1-ol |
| SMILES | CC(N)C(SCCCO)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H16BrNOS2/c1-7(12)10(14-6-2-5-13)8-3-4-9(11)15-8/h3-4,7,10,13H,2,5-6,12H2,1H3 |
| InChIKey | DNGHBNOJYARSKR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|