C10H12BrN3S2 — CID 107779753
1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)propan-2-amine (PubChem CID 107779753) has the molecular formula C10H12BrN3S2 and a molecular weight of 318.27 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)propan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 107779753 |
| Molecular Formula | C10H12BrN3S2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)propan-2-amine |
| SMILES | CC(N)C(Sc1ncc[nH]1)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H12BrN3S2/c1-6(12)9(7-2-3-8(11)15-7)16-10-13-4-5-14-10/h2-6,9H,12H2,1H3,(H,13,14) |
| InChIKey | MOTWVVSEIAJVDX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |