C11H14BrN3S2 — CID 114000660
1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)butan-2-amine (PubChem CID 114000660) has the molecular formula C11H14BrN3S2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)butan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 114000660 |
| Molecular Formula | C11H14BrN3S2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-1-(1H-imidazol-2-ylsulfanyl)butan-2-amine |
| SMILES | CCC(N)C(Sc1ncc[nH]1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H14BrN3S2/c1-2-7(13)10(8-3-4-9(12)16-8)17-11-14-5-6-15-11/h3-7,10H,2,13H2,1H3,(H,14,15) |
| InChIKey | BPJFOCFJYKKTBX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |