C17H22BrNS2 — CID 63539407
1-(5-bromothiophen-2-yl)-1-(4-propan-2-ylphenyl)sulfanylbutan-2-amine (PubChem CID 63539407) has the molecular formula C17H22BrNS2 and a molecular weight of 384.41 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-1-(4-propan-2-ylphenyl)sulfanylbutan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-1-(4-propan-2-ylphenyl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 63539407 |
| Molecular Formula | C17H22BrNS2 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-1-(4-propan-2-ylphenyl)sulfanylbutan-2-amine |
| SMILES | CCC(N)C(Sc1ccc(C(C)C)cc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H22BrNS2/c1-4-14(19)17(15-9-10-16(18)21-15)20-13-7-5-12(6-8-13)11(2)3/h5-11,14,17H,4,19H2,1-3H3 |
| InChIKey | QVKIFJTVZXXDLP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |