C12H15F3O2S — CID 107772317
3-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]sulfanylbutan-2-ol (PubChem CID 107772317) has the molecular formula C12H15F3O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 3-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]sulfanylbutan-2-ol.
| Compound Name | 3-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107772317 |
| Molecular Formula | C12H15F3O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[4-(hydroxymethyl)-2-(trifluoromethyl)phenyl]sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)Sc1ccc(CO)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3O2S/c1-7(17)8(2)18-11-4-3-9(6-16)5-10(11)12(13,14)15/h3-5,7-8,16-17H,6H2,1-2H3 |
| InChIKey | YPUPIINVULFJFR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |