C13H16N2O5S — CID 107775553
(2R)-2-acetamido-3-[(3-carbamoylphenyl)methylsulfinyl]propanoic acid (PubChem CID 107775553) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(3-carbamoylphenyl)methylsulfinyl]propanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(3-carbamoylphenyl)methylsulfinyl]propanoic acid |
|---|---|
| PubChem CID | 107775553 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (2R)-2-acetamido-3-[(3-carbamoylphenyl)methylsulfinyl]propanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)Cc1cccc(C(N)=O)c1)C(=O)O |
| InChI | InChI=1S/C13H16N2O5S/c1-8(16)15-11(13(18)19)7-21(20)6-9-3-2-4-10(5-9)12(14)17/h2-5,11H,6-7H2,1H3,(H2,14,17)(H,15,16)(H,18,19)/t11-,21?/m0/s1 |
| InChIKey | GOFLGBQCIMKTOX-QHIQZGGMSA-N |
| XLogP | -0.38 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |