C10H17NO5S — CID 107775574
(2R)-2-acetamido-3-(oxan-3-ylsulfinyl)propanoic acid (PubChem CID 107775574) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(oxan-3-ylsulfinyl)propanoic acid.
| Compound Name | (2R)-2-acetamido-3-(oxan-3-ylsulfinyl)propanoic acid |
|---|---|
| PubChem CID | 107775574 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2R)-2-acetamido-3-(oxan-3-ylsulfinyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CS(=O)C1CCCOC1)C(=O)O |
| InChI | InChI=1S/C10H17NO5S/c1-7(12)11-9(10(13)14)6-17(15)8-3-2-4-16-5-8/h8-9H,2-6H2,1H3,(H,11,12)(H,13,14)/t8?,9-,17?/m0/s1 |
| InChIKey | FXLFJAQPQYPPOW-QFGKHMNFSA-N |
| XLogP | -0.50 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |